C13H12N4S — CID 5310854
6-methyl-3-prop-2-enylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole (PubChem CID 5310854) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 6-methyl-3-prop-2-enylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole.
| Compound Name | 6-methyl-3-prop-2-enylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole |
|---|---|
| PubChem CID | 5310854 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6-methyl-3-prop-2-enylsulfanyl-5H-[1,2,4]triazino[5,6-b]indole |
| SMILES | C=CCSc1nnc2c(n1)[nH]c1c(C)cccc12 |
| InChI | InChI=1S/C13H12N4S/c1-3-7-18-13-15-12-11(16-17-13)9-6-4-5-8(2)10(9)14-12/h3-6H,1,7H2,2H3,(H,14,15,17) |
| InChIKey | DSNPRSDQOUSZDD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|