About N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide
N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide (PubChem CID 5310864) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide.
Molecular Properties
| Compound Name | N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide |
| PubChem CID | 5310864 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide |
| SMILES | C/C(NC(=O)c1ccccc1)=C1/C(=O)CC2C1C2(C)C |
| InChI | InChI=1S/C17H19NO2/c1-10(18-16(20)11-7-5-4-6-8-11)14-13(19)9-12-15(14)17(12,2)3/h4-8,12,15H,9H2,1-3H3,(H,18,20)/b14-10+ |
| InChIKey | AEGPEQPADQUZBA-GXDHUFHOSA-N |
| XLogP | 2.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide?
The IUPAC name of N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide (CID 5310864) is N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide.
What is the SMILES notation for N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide?
The canonical SMILES for N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide is C/C(NC(=O)c1ccccc1)=C1/C(=O)CC2C1C2(C)C.
What is the InChIKey of N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide?
The InChIKey is AEGPEQPADQUZBA-GXDHUFHOSA-N. The full InChI is InChI=1S/C17H19NO2/c1-10(18-16(20)11-7-5-4-6-8-11)14-13(19)9-12-15(14)17(12,2)3/h4-8,12,15H,9H2,1-3H3,(H,18,20)/b14-10+.
What are the key properties of N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide?
N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide has a molecular weight of 269.34 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]benzamide is sourced from PubChem (CID 5310864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).