C22H21ClN4O — CID 53108739
N-[(2-chlorophenyl)methyl]-3-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide (PubChem CID 53108739) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 53108739 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
| SMILES | O=C(NCc1ccccc1Cl)c1cccc(-c2cnc(N3CCCC3)nc2)c1 |
| InChI | InChI=1S/C22H21ClN4O/c23-20-9-2-1-6-18(20)13-24-21(28)17-8-5-7-16(12-17)19-14-25-22(26-15-19)27-10-3-4-11-27/h1-2,5-9,12,14-15H,3-4,10-11,13H2,(H,24,28) |
| InChIKey | GYVSYBNXEIJCKR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |