C24H27N3O4 — CID 53110053
5-[[4-(butanoylamino)phenoxy]methyl]-N-(3-phenylpropyl)-1,2-oxazole-3-carboxamide (PubChem CID 53110053) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 5-[[4-(butanoylamino)phenoxy]methyl]-N-(3-phenylpropyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[[4-(butanoylamino)phenoxy]methyl]-N-(3-phenylpropyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 53110053 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 5-[[4-(butanoylamino)phenoxy]methyl]-N-(3-phenylpropyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCC(=O)Nc1ccc(OCc2cc(C(=O)NCCCc3ccccc3)no2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-2-7-23(28)26-19-11-13-20(14-12-19)30-17-21-16-22(27-31-21)24(29)25-15-6-10-18-8-4-3-5-9-18/h3-5,8-9,11-14,16H,2,6-7,10,15,17H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | VZQJMMGUSAMKBV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|