C22H24F2N2O2 — CID 53110383
1-(4-acetamidophenyl)-N-[(3,5-difluorophenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 53110383) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-(4-acetamidophenyl)-N-[(3,5-difluorophenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-acetamidophenyl)-N-[(3,5-difluorophenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 53110383 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-(4-acetamidophenyl)-N-[(3,5-difluorophenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(C2(C(=O)NCc3cc(F)cc(F)c3)CCCCC2)cc1 |
| InChI | InChI=1S/C22H24F2N2O2/c1-15(27)26-20-7-5-17(6-8-20)22(9-3-2-4-10-22)21(28)25-14-16-11-18(23)13-19(24)12-16/h5-8,11-13H,2-4,9-10,14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | DRILIVYSSXSSFE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |