C22H19ClN4O — CID 53111242
N-(5-chloro-2-methylphenyl)-1-[(2-methylphenyl)methyl]benzotriazole-5-carboxamide (PubChem CID 53111242) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-1-[(2-methylphenyl)methyl]benzotriazole-5-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-1-[(2-methylphenyl)methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 53111242 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-1-[(2-methylphenyl)methyl]benzotriazole-5-carboxamide |
| SMILES | Cc1ccccc1Cn1nnc2cc(C(=O)Nc3cc(Cl)ccc3C)ccc21 |
| InChI | InChI=1S/C22H19ClN4O/c1-14-5-3-4-6-17(14)13-27-21-10-8-16(11-20(21)25-26-27)22(28)24-19-12-18(23)9-7-15(19)2/h3-12H,13H2,1-2H3,(H,24,28) |
| InChIKey | IUTBJLWFLZBZID-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |