C11H13NO5 — CID 5311218
(2S,3S)-2-amino-3-phenylmethoxybutanedioic acid (PubChem CID 5311218) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-phenylmethoxybutanedioic acid.
| Compound Name | (2S,3S)-2-amino-3-phenylmethoxybutanedioic acid |
|---|---|
| PubChem CID | 5311218 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2S,3S)-2-amino-3-phenylmethoxybutanedioic acid |
| SMILES | N[C@H](C(=O)O)[C@H](OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO5/c12-8(10(13)14)9(11(15)16)17-6-7-4-2-1-3-5-7/h1-5,8-9H,6,12H2,(H,13,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | BYOBCYXURWDEDS-IUCAKERBSA-N |
| XLogP | 0.07 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |