C20H26N2O5S2 — CID 53112412
N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2,4-dimethoxybenzamide (PubChem CID 53112412) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 53112412 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[[5-(azepan-1-ylsulfonyl)thiophen-2-yl]methyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCCCCC3)s2)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O5S2/c1-26-15-7-9-17(18(13-15)27-2)20(23)21-14-16-8-10-19(28-16)29(24,25)22-11-5-3-4-6-12-22/h7-10,13H,3-6,11-12,14H2,1-2H3,(H,21,23) |
| InChIKey | RTNMIAZPNSYNOB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |