C13H20ClN5O8P2 — CID 5311301
[(1R,2S,4R)-4-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-2-phosphonooxycyclopentyl]methyl dihydrogen phosphate (PubChem CID 5311301) has the molecular formula C13H20ClN5O8P2 and a molecular weight of 471.73 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-2-phosphonooxycyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,2S,4R)-4-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-2-phosphonooxycyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 5311301 |
| Molecular Formula | C13H20ClN5O8P2 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | [(1R,2S,4R)-4-[[2-chloro-6-(methylamino)purin-9-yl]methyl]-2-phosphonooxycyclopentyl]methyl dihydrogen phosphate |
| SMILES | CNc1nc(Cl)nc2c1ncn2C[C@@H]1C[C@H](COP(=O)(O)O)[C@@H](OP(=O)(O)O)C1 |
| InChI | InChI=1S/C13H20ClN5O8P2/c1-15-11-10-12(18-13(14)17-11)19(6-16-10)4-7-2-8(5-26-28(20,21)22)9(3-7)27-29(23,24)25/h6-9H,2-5H2,1H3,(H,15,17,18)(H2,20,21,22)(H2,23,24,25)/t7-,8-,9+/m1/s1 |
| InChIKey | LPZJKPSGEADHTQ-HLTSFMKQSA-N |
| XLogP | 1.13 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|