C20H17ClN2O5 — CID 53113143
methyl 6-chloro-4-[2-(3-methoxyanilino)-2-oxoethoxy]quinoline-2-carboxylate (PubChem CID 53113143) has the molecular formula C20H17ClN2O5 and a molecular weight of 400.82 g/mol. Its IUPAC name is methyl 6-chloro-4-[2-(3-methoxyanilino)-2-oxoethoxy]quinoline-2-carboxylate.
| Compound Name | methyl 6-chloro-4-[2-(3-methoxyanilino)-2-oxoethoxy]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 53113143 |
| Molecular Formula | C20H17ClN2O5 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | methyl 6-chloro-4-[2-(3-methoxyanilino)-2-oxoethoxy]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(OCC(=O)Nc2cccc(OC)c2)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C20H17ClN2O5/c1-26-14-5-3-4-13(9-14)22-19(24)11-28-18-10-17(20(25)27-2)23-16-7-6-12(21)8-15(16)18/h3-10H,11H2,1-2H3,(H,22,24) |
| InChIKey | CYUPVGCDRRYXIX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |