C20H20N2O2 — CID 53113261
methyl 4-(3,4-dimethylanilino)-6-methylquinoline-2-carboxylate (PubChem CID 53113261) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 4-(3,4-dimethylanilino)-6-methylquinoline-2-carboxylate.
| Compound Name | methyl 4-(3,4-dimethylanilino)-6-methylquinoline-2-carboxylate |
|---|---|
| PubChem CID | 53113261 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl 4-(3,4-dimethylanilino)-6-methylquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(Nc2ccc(C)c(C)c2)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C20H20N2O2/c1-12-5-8-17-16(9-12)18(11-19(22-17)20(23)24-4)21-15-7-6-13(2)14(3)10-15/h5-11H,1-4H3,(H,21,22) |
| InChIKey | AFEDPKXRQXGAPI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |