C26H35N5O3 — CID 53116037
3-[4-(azepan-1-yl)-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-6-yl]-N-[(4-butoxyphenyl)methyl]propanamide (PubChem CID 53116037) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-[4-(azepan-1-yl)-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-6-yl]-N-[(4-butoxyphenyl)methyl]propanamide.
| Compound Name | 3-[4-(azepan-1-yl)-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-6-yl]-N-[(4-butoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 53116037 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 3-[4-(azepan-1-yl)-3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-6-yl]-N-[(4-butoxyphenyl)methyl]propanamide |
| SMILES | CCCCOc1ccc(CNC(=O)CCc2nc(N3CCCCCC3)c3c(C)noc3n2)cc1 |
| InChI | InChI=1S/C26H35N5O3/c1-3-4-17-33-21-11-9-20(10-12-21)18-27-23(32)14-13-22-28-25(31-15-7-5-6-8-16-31)24-19(2)30-34-26(24)29-22/h9-12H,3-8,13-18H2,1-2H3,(H,27,32) |
| InChIKey | BHCAHYSKNFGZGX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|