C16H10ClN3O4S — CID 5311682
5-[3-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-chlorobenzoic acid (PubChem CID 5311682) has the molecular formula C16H10ClN3O4S and a molecular weight of 375.79 g/mol. Its IUPAC name is 5-[3-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[3-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 5311682 |
| Molecular Formula | C16H10ClN3O4S |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 5-[3-(1,3-benzodioxol-5-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(-n2c(-c3ccc4c(c3)OCO4)n[nH]c2=S)ccc1Cl |
| InChI | InChI=1S/C16H10ClN3O4S/c17-11-3-2-9(6-10(11)15(21)22)20-14(18-19-16(20)25)8-1-4-12-13(5-8)24-7-23-12/h1-6H,7H2,(H,19,25)(H,21,22) |
| InChIKey | OMXKUPXCFDLPII-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|