C20H23BrN2O4 — CID 53117062
1-(5-bromofuran-2-carbonyl)-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide (PubChem CID 53117062) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 1-(5-bromofuran-2-carbonyl)-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide.
| Compound Name | 1-(5-bromofuran-2-carbonyl)-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 53117062 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-(5-bromofuran-2-carbonyl)-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)C2(C)CCCN(C(=O)c3ccc(Br)o3)C2)c1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-20(19(25)22-12-14-5-3-6-15(11-14)26-2)9-4-10-23(13-20)18(24)16-7-8-17(21)27-16/h3,5-8,11H,4,9-10,12-13H2,1-2H3,(H,22,25) |
| InChIKey | SBFNHQPSSRLVKZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |