About 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide
1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide (PubChem CID 53117259) has the molecular formula C24H31N3O3
and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide |
| PubChem CID | 53117259 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCCC(C)(C(=O)NCc3cccc(OC)c3)C2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-4-18-9-11-20(12-10-18)26-23(29)27-14-6-13-24(2,17-27)22(28)25-16-19-7-5-8-21(15-19)30-3/h5,7-12,15H,4,6,13-14,16-17H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | JSPMUORFCZTMQT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide?
The IUPAC name of 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide (CID 53117259) is 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide.
What is the SMILES notation for 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide?
The canonical SMILES for 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide is CCc1ccc(NC(=O)N2CCCC(C)(C(=O)NCc3cccc(OC)c3)C2)cc1.
What is the InChIKey of 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide?
The InChIKey is JSPMUORFCZTMQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O3/c1-4-18-9-11-20(12-10-18)26-23(29)27-14-6-13-24(2,17-27)22(28)25-16-19-7-5-8-21(15-19)30-3/h5,7-12,15H,4,6,13-14,16-17H2,1-3H3,(H,25,28)(H,26,29).
What are the key properties of 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide?
1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide has a molecular weight of 409.53 g/mol, XLogP of 4.21, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(4-ethylphenyl)-3-N-[(3-methoxyphenyl)methyl]-3-methylpiperidine-1,3-dicarboxamide is sourced from PubChem (CID 53117259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).