About 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one
2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one (PubChem CID 53118025) has the molecular formula C20H16ClN3O3
and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one |
| PubChem CID | 53118025 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one |
| SMILES | COc1ccc(-n2ccn3cc(-c4ccc(Cl)cc4)nc3c2=O)cc1OC |
| InChI | InChI=1S/C20H16ClN3O3/c1-26-17-8-7-15(11-18(17)27-2)24-10-9-23-12-16(22-19(23)20(24)25)13-3-5-14(21)6-4-13/h3-12H,1-2H3 |
| InChIKey | FARCMGKTAXWCMZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one?
The IUPAC name of 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one (CID 53118025) is 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one.
What is the SMILES notation for 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one?
The canonical SMILES for 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one is COc1ccc(-n2ccn3cc(-c4ccc(Cl)cc4)nc3c2=O)cc1OC.
What is the InChIKey of 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one?
The InChIKey is FARCMGKTAXWCMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O3/c1-26-17-8-7-15(11-18(17)27-2)24-10-9-23-12-16(22-19(23)20(24)25)13-3-5-14(21)6-4-13/h3-12H,1-2H3.
What are the key properties of 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one?
2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one has a molecular weight of 381.82 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-7-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-one is sourced from PubChem (CID 53118025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).