C17H22N4O2S — CID 53119268
N-butyl-2-(2-morpholin-4-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 53119268) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-butyl-2-(2-morpholin-4-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-2-(2-morpholin-4-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 53119268 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-butyl-2-(2-morpholin-4-yl-4-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(-c2ccnc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-3-5-19-16(22)14-12-24-17(20-14)13-4-6-18-15(11-13)21-7-9-23-10-8-21/h4,6,11-12H,2-3,5,7-10H2,1H3,(H,19,22) |
| InChIKey | JQHOERDPUAPGPO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|