C22H26N4O2S — CID 53119636
N-[3-(azepan-1-yl)propyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide (PubChem CID 53119636) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53119636 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-5-(5-phenyl-1,2,4-oxadiazol-3-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1)c1ccc(-c2noc(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C22H26N4O2S/c27-21(23-13-8-16-26-14-6-1-2-7-15-26)19-12-11-18(29-19)20-24-22(28-25-20)17-9-4-3-5-10-17/h3-5,9-12H,1-2,6-8,13-16H2,(H,23,27) |
| InChIKey | DMVROHRXHQJKOY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|