C24H24FN3O2 — CID 53119894
N-cycloheptyl-3-[6-(4-fluorophenyl)pyrimidin-4-yl]oxybenzamide (PubChem CID 53119894) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is N-cycloheptyl-3-[6-(4-fluorophenyl)pyrimidin-4-yl]oxybenzamide.
| Compound Name | N-cycloheptyl-3-[6-(4-fluorophenyl)pyrimidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 53119894 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-cycloheptyl-3-[6-(4-fluorophenyl)pyrimidin-4-yl]oxybenzamide |
| SMILES | O=C(NC1CCCCCC1)c1cccc(Oc2cc(-c3ccc(F)cc3)ncn2)c1 |
| InChI | InChI=1S/C24H24FN3O2/c25-19-12-10-17(11-13-19)22-15-23(27-16-26-22)30-21-9-5-6-18(14-21)24(29)28-20-7-3-1-2-4-8-20/h5-6,9-16,20H,1-4,7-8H2,(H,28,29) |
| InChIKey | ZZPZSEGBWFPOGW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |