C25H34N6O2 — CID 53120831
N-(3-ethoxypropyl)-4-[[3-(4-ethylphenyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazine-1-carboxamide (PubChem CID 53120831) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-[[3-(4-ethylphenyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-4-[[3-(4-ethylphenyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53120831 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | N-(3-ethoxypropyl)-4-[[3-(4-ethylphenyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazine-1-carboxamide |
| SMILES | CCOCCCNC(=O)N1CCN(Cc2nc3cccnc3n2-c2ccc(CC)cc2)CC1 |
| InChI | InChI=1S/C25H34N6O2/c1-3-20-8-10-21(11-9-20)31-23(28-22-7-5-12-26-24(22)31)19-29-14-16-30(17-15-29)25(32)27-13-6-18-33-4-2/h5,7-12H,3-4,6,13-19H2,1-2H3,(H,27,32) |
| InChIKey | FNVLDYNUCXJAOL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|