C27H38O5S — CID 5312121
(2E,4E,6E)-7-(7-heptoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 5312121) has the molecular formula C27H38O5S and a molecular weight of 474.66 g/mol. Its IUPAC name is (2E,4E,6E)-7-(7-heptoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-7-(7-heptoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 5312121 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (2E,4E,6E)-7-(7-heptoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CCCCCCCOc1cc2c(cc1/C(C)=C/C=C/C(C)=C/C(=O)O)C(C)(C)CCS2(=O)=O |
| InChI | InChI=1S/C27H38O5S/c1-6-7-8-9-10-15-32-24-19-25-23(27(4,5)14-16-33(25,30)31)18-22(24)21(3)13-11-12-20(2)17-26(28)29/h11-13,17-19H,6-10,14-16H2,1-5H3,(H,28,29)/b12-11+,20-17+,21-13+ |
| InChIKey | DAQXGPCMSTXZBM-BAKLMJQHSA-N |
| XLogP | 6.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|