C21H23N3O5S — CID 53121305
3-ethyl-6-[4-(3-methylbenzoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one (PubChem CID 53121305) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-ethyl-6-[4-(3-methylbenzoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one.
| Compound Name | 3-ethyl-6-[4-(3-methylbenzoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 53121305 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-ethyl-6-[4-(3-methylbenzoyl)piperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2cc(S(=O)(=O)N3CCN(C(=O)c4cccc(C)c4)CC3)ccc21 |
| InChI | InChI=1S/C21H23N3O5S/c1-3-24-18-8-7-17(14-19(18)29-21(24)26)30(27,28)23-11-9-22(10-12-23)20(25)16-6-4-5-15(2)13-16/h4-8,13-14H,3,9-12H2,1-2H3 |
| InChIKey | QYVMIGXJDABOIU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |