C27H32N4O3 — CID 53122841
N-[3-[benzyl(methyl)amino]propyl]-5-[2-(piperidine-1-carbonyl)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 53122841) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-5-[2-(piperidine-1-carbonyl)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-5-[2-(piperidine-1-carbonyl)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53122841 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-5-[2-(piperidine-1-carbonyl)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CN(CCCNC(=O)c1ncoc1-c1ccccc1C(=O)N1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N4O3/c1-30(19-21-11-4-2-5-12-21)16-10-15-28-26(32)24-25(34-20-29-24)22-13-6-7-14-23(22)27(33)31-17-8-3-9-18-31/h2,4-7,11-14,20H,3,8-10,15-19H2,1H3,(H,28,32) |
| InChIKey | WHZQZGUEPDNGBC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|