(5E,8E)-deca-5,8-dienoic acid

C10H16O2 — CID 5312364

IUPAC(5E,8E)-deca-5,8-dienoic acid
SMILESC/C=C/C/C=C/CCCC(=O)O
InChIInChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-3,5-6H,4,7-9H2,1H3,(H,11,12)/b3-2+,6-5+
InChIKeyQEIXPEPQEMBGFO-ZIMISOLQSA-N
MW168.24 g/mol
LogP2.76
Rot. Bonds6

About (5E,8E)-deca-5,8-dienoic acid

(5E,8E)-deca-5,8-dienoic acid (PubChem CID 5312364) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (5E,8E)-deca-5,8-dienoic acid.

Molecular Properties

Compound Name(5E,8E)-deca-5,8-dienoic acid
PubChem CID5312364
Molecular FormulaC10H16O2
Molecular Weight168.24 g/mol
Exact Mass168.12
IUPAC Name(5E,8E)-deca-5,8-dienoic acid
SMILESC/C=C/C/C=C/CCCC(=O)O
InChIInChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-3,5-6H,4,7-9H2,1H3,(H,11,12)/b3-2+,6-5+
InChIKeyQEIXPEPQEMBGFO-ZIMISOLQSA-N
XLogP2.76
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.24
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (5E,8E)-deca-5,8-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5E,8E)-deca-5,8-dienoic acid?
The IUPAC name of (5E,8E)-deca-5,8-dienoic acid (CID 5312364) is (5E,8E)-deca-5,8-dienoic acid.
What is the SMILES notation for (5E,8E)-deca-5,8-dienoic acid?
The canonical SMILES for (5E,8E)-deca-5,8-dienoic acid is C/C=C/C/C=C/CCCC(=O)O.
What is the InChIKey of (5E,8E)-deca-5,8-dienoic acid?
The InChIKey is QEIXPEPQEMBGFO-ZIMISOLQSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-3,5-6H,4,7-9H2,1H3,(H,11,12)/b3-2+,6-5+.
What are the key properties of (5E,8E)-deca-5,8-dienoic acid?
(5E,8E)-deca-5,8-dienoic acid has a molecular weight of 168.24 g/mol, XLogP of 2.76, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,8E)-deca-5,8-dienoic acid is sourced from PubChem (CID 5312364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).