(2Z,8Z)-dodeca-2,8-dienoic acid

C12H20O2 — CID 5312387

IUPAC(2Z,8Z)-dodeca-2,8-dienoic acid
SMILESCCC/C=C\CCCC/C=C\C(=O)O
InChIInChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h4-5,10-11H,2-3,6-9H2,1H3,(H,13,14)/b5-4-,11-10-
InChIKeyFWXDEWYURMQUOL-NKIGAPEHSA-N
MW196.29 g/mol
LogP3.54
Rot. Bonds8

About (2Z,8Z)-dodeca-2,8-dienoic acid

(2Z,8Z)-dodeca-2,8-dienoic acid (PubChem CID 5312387) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2Z,8Z)-dodeca-2,8-dienoic acid.

Molecular Properties

Compound Name(2Z,8Z)-dodeca-2,8-dienoic acid
PubChem CID5312387
Molecular FormulaC12H20O2
Molecular Weight196.29 g/mol
Exact Mass196.15
IUPAC Name(2Z,8Z)-dodeca-2,8-dienoic acid
SMILESCCC/C=C\CCCC/C=C\C(=O)O
InChIInChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h4-5,10-11H,2-3,6-9H2,1H3,(H,13,14)/b5-4-,11-10-
InChIKeyFWXDEWYURMQUOL-NKIGAPEHSA-N
XLogP3.54
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.29
LogP ≤ 53.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2Z,8Z)-dodeca-2,8-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,8Z)-dodeca-2,8-dienoic acid?
The IUPAC name of (2Z,8Z)-dodeca-2,8-dienoic acid (CID 5312387) is (2Z,8Z)-dodeca-2,8-dienoic acid.
What is the SMILES notation for (2Z,8Z)-dodeca-2,8-dienoic acid?
The canonical SMILES for (2Z,8Z)-dodeca-2,8-dienoic acid is CCC/C=C\CCCC/C=C\C(=O)O.
What is the InChIKey of (2Z,8Z)-dodeca-2,8-dienoic acid?
The InChIKey is FWXDEWYURMQUOL-NKIGAPEHSA-N. The full InChI is InChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h4-5,10-11H,2-3,6-9H2,1H3,(H,13,14)/b5-4-,11-10-.
What are the key properties of (2Z,8Z)-dodeca-2,8-dienoic acid?
(2Z,8Z)-dodeca-2,8-dienoic acid has a molecular weight of 196.29 g/mol, XLogP of 3.54, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,8Z)-dodeca-2,8-dienoic acid is sourced from PubChem (CID 5312387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).