(Z)-hexadec-6-enoic acid

C16H30O2 — CID 5312419

IUPAC(Z)-hexadec-6-enoic acid
SMILESCCCCCCCCC/C=C\CCCCC(=O)O
InChIInChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h10-11H,2-9,12-15H2,1H3,(H,17,18)/b11-10-
InChIKeyNNNVXFKZMRGJPM-KHPPLWFESA-N
MW254.41 g/mol
LogP5.33
Rot. Bonds13

About (Z)-hexadec-6-enoic acid

(Z)-hexadec-6-enoic acid (PubChem CID 5312419) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (Z)-hexadec-6-enoic acid.

Molecular Properties

Compound Name(Z)-hexadec-6-enoic acid
PubChem CID5312419
Molecular FormulaC16H30O2
Molecular Weight254.41 g/mol
Exact Mass254.22
IUPAC Name(Z)-hexadec-6-enoic acid
SMILESCCCCCCCCC/C=C\CCCCC(=O)O
InChIInChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h10-11H,2-9,12-15H2,1H3,(H,17,18)/b11-10-
InChIKeyNNNVXFKZMRGJPM-KHPPLWFESA-N
XLogP5.33
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms18
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500254.41
LogP ≤ 55.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-hexadec-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-hexadec-6-enoic acid?
The IUPAC name of (Z)-hexadec-6-enoic acid (CID 5312419) is (Z)-hexadec-6-enoic acid.
What is the SMILES notation for (Z)-hexadec-6-enoic acid?
The canonical SMILES for (Z)-hexadec-6-enoic acid is CCCCCCCCC/C=C\CCCCC(=O)O.
What is the InChIKey of (Z)-hexadec-6-enoic acid?
The InChIKey is NNNVXFKZMRGJPM-KHPPLWFESA-N. The full InChI is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h10-11H,2-9,12-15H2,1H3,(H,17,18)/b11-10-.
What are the key properties of (Z)-hexadec-6-enoic acid?
(Z)-hexadec-6-enoic acid has a molecular weight of 254.41 g/mol, XLogP of 5.33, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hexadec-6-enoic acid is sourced from PubChem (CID 5312419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).