C22H33N3O6S — CID 53124882
2-[1-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 53124882) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[1-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[1-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 53124882 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-[1-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]piperidin-4-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CCn1c(=O)oc2cc(S(=O)(=O)N3CCC(CC(=O)NCCCOC(C)C)CC3)ccc21 |
| InChI | InChI=1S/C22H33N3O6S/c1-4-25-19-7-6-18(15-20(19)31-22(25)27)32(28,29)24-11-8-17(9-12-24)14-21(26)23-10-5-13-30-16(2)3/h6-7,15-17H,4-5,8-14H2,1-3H3,(H,23,26) |
| InChIKey | ZMWCLZGPOXNCSJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|