(3S)-3-hydroxydodecanoic acid

C12H24O3 — CID 5312805

IUPAC(3S)-3-hydroxydodecanoic acid
SMILESCCCCCCCCC[C@H](O)CC(=O)O
InChIInChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1
InChIKeyMUCMKTPAZLSKTL-NSHDSACASA-N
MW216.32 g/mol
LogP2.96
Rot. Bonds10

About (3S)-3-hydroxydodecanoic acid

(3S)-3-hydroxydodecanoic acid (PubChem CID 5312805) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (3S)-3-hydroxydodecanoic acid.

Molecular Properties

Compound Name(3S)-3-hydroxydodecanoic acid
PubChem CID5312805
Molecular FormulaC12H24O3
Molecular Weight216.32 g/mol
Exact Mass216.17
IUPAC Name(3S)-3-hydroxydodecanoic acid
SMILESCCCCCCCCC[C@H](O)CC(=O)O
InChIInChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1
InChIKeyMUCMKTPAZLSKTL-NSHDSACASA-N
XLogP2.96
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.32
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (3S)-3-hydroxydodecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-hydroxydodecanoic acid?
The IUPAC name of (3S)-3-hydroxydodecanoic acid (CID 5312805) is (3S)-3-hydroxydodecanoic acid.
What is the SMILES notation for (3S)-3-hydroxydodecanoic acid?
The canonical SMILES for (3S)-3-hydroxydodecanoic acid is CCCCCCCCC[C@H](O)CC(=O)O.
What is the InChIKey of (3S)-3-hydroxydodecanoic acid?
The InChIKey is MUCMKTPAZLSKTL-NSHDSACASA-N. The full InChI is InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1.
What are the key properties of (3S)-3-hydroxydodecanoic acid?
(3S)-3-hydroxydodecanoic acid has a molecular weight of 216.32 g/mol, XLogP of 2.96, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxydodecanoic acid is sourced from PubChem (CID 5312805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).