About (3S)-3-hydroxydodecanoic acid
(3S)-3-hydroxydodecanoic acid (PubChem CID 5312805) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is (3S)-3-hydroxydodecanoic acid.
Molecular Properties
| Compound Name | (3S)-3-hydroxydodecanoic acid |
| PubChem CID | 5312805 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (3S)-3-hydroxydodecanoic acid |
| SMILES | CCCCCCCCC[C@H](O)CC(=O)O |
| InChI | InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | MUCMKTPAZLSKTL-NSHDSACASA-N |
| XLogP | 2.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-hydroxydodecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxydodecanoic acid?
The IUPAC name of (3S)-3-hydroxydodecanoic acid (CID 5312805) is (3S)-3-hydroxydodecanoic acid.
What is the SMILES notation for (3S)-3-hydroxydodecanoic acid?
The canonical SMILES for (3S)-3-hydroxydodecanoic acid is CCCCCCCCC[C@H](O)CC(=O)O.
What is the InChIKey of (3S)-3-hydroxydodecanoic acid?
The InChIKey is MUCMKTPAZLSKTL-NSHDSACASA-N. The full InChI is InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1.
What are the key properties of (3S)-3-hydroxydodecanoic acid?
(3S)-3-hydroxydodecanoic acid has a molecular weight of 216.32 g/mol, XLogP of 2.96, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxydodecanoic acid is sourced from PubChem (CID 5312805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).