(Z,3R)-3-hydroxydodec-5-enoic acid

C12H22O3 — CID 5312807

IUPAC(Z,3R)-3-hydroxydodec-5-enoic acid
SMILESCCCCCC/C=C\C[C@@H](O)CC(=O)O
InChIInChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h7-8,11,13H,2-6,9-10H2,1H3,(H,14,15)/b8-7-/t11-/m1/s1
InChIKeyGZUALOWLHSCENG-SKVAFPRGSA-N
MW214.31 g/mol
LogP2.74
Rot. Bonds9

About (Z,3R)-3-hydroxydodec-5-enoic acid

(Z,3R)-3-hydroxydodec-5-enoic acid (PubChem CID 5312807) has the molecular formula C12H22O3 and a molecular weight of 214.31 g/mol. Its IUPAC name is (Z,3R)-3-hydroxydodec-5-enoic acid.

Molecular Properties

Compound Name(Z,3R)-3-hydroxydodec-5-enoic acid
PubChem CID5312807
Molecular FormulaC12H22O3
Molecular Weight214.31 g/mol
Exact Mass214.16
IUPAC Name(Z,3R)-3-hydroxydodec-5-enoic acid
SMILESCCCCCC/C=C\C[C@@H](O)CC(=O)O
InChIInChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h7-8,11,13H,2-6,9-10H2,1H3,(H,14,15)/b8-7-/t11-/m1/s1
InChIKeyGZUALOWLHSCENG-SKVAFPRGSA-N
XLogP2.74
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z,3R)-3-hydroxydodec-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z,3R)-3-hydroxydodec-5-enoic acid?
The IUPAC name of (Z,3R)-3-hydroxydodec-5-enoic acid (CID 5312807) is (Z,3R)-3-hydroxydodec-5-enoic acid.
What is the SMILES notation for (Z,3R)-3-hydroxydodec-5-enoic acid?
The canonical SMILES for (Z,3R)-3-hydroxydodec-5-enoic acid is CCCCCC/C=C\C[C@@H](O)CC(=O)O.
What is the InChIKey of (Z,3R)-3-hydroxydodec-5-enoic acid?
The InChIKey is GZUALOWLHSCENG-SKVAFPRGSA-N. The full InChI is InChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h7-8,11,13H,2-6,9-10H2,1H3,(H,14,15)/b8-7-/t11-/m1/s1.
What are the key properties of (Z,3R)-3-hydroxydodec-5-enoic acid?
(Z,3R)-3-hydroxydodec-5-enoic acid has a molecular weight of 214.31 g/mol, XLogP of 2.74, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3R)-3-hydroxydodec-5-enoic acid is sourced from PubChem (CID 5312807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).