C18H32O3 — CID 5312830
(9S,10E,12Z)-9-hydroxyoctadeca-10,12-dienoic acid (PubChem CID 5312830) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (9S,10E,12Z)-9-hydroxyoctadeca-10,12-dienoic acid.
| Compound Name | (9S,10E,12Z)-9-hydroxyoctadeca-10,12-dienoic acid |
|---|---|
| PubChem CID | 5312830 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (9S,10E,12Z)-9-hydroxyoctadeca-10,12-dienoic acid |
| SMILES | CCCCC/C=C\C=C\[C@@H](O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14,17,19H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+/t17-/m1/s1 |
| InChIKey | NPDSHTNEKLQQIJ-UINYOVNOSA-N |
| XLogP | 4.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|