About 8-hydroxyoctadec-17-en-9,11-diynoic acid
8-hydroxyoctadec-17-en-9,11-diynoic acid (PubChem CID 5312840) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is 8-hydroxyoctadec-17-en-9,11-diynoic acid.
Molecular Properties
| Compound Name | 8-hydroxyoctadec-17-en-9,11-diynoic acid |
| PubChem CID | 5312840 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 8-hydroxyoctadec-17-en-9,11-diynoic acid |
| SMILES | C=CCCCCC#CC#CC(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h2,17,19H,1,3-6,9-10,12-13,15-16H2,(H,20,21) |
| InChIKey | KWLVIGJGNBJKPA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxyoctadec-17-en-9,11-diynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxyoctadec-17-en-9,11-diynoic acid?
The IUPAC name of 8-hydroxyoctadec-17-en-9,11-diynoic acid (CID 5312840) is 8-hydroxyoctadec-17-en-9,11-diynoic acid.
What is the SMILES notation for 8-hydroxyoctadec-17-en-9,11-diynoic acid?
The canonical SMILES for 8-hydroxyoctadec-17-en-9,11-diynoic acid is C=CCCCCC#CC#CC(O)CCCCCCC(=O)O.
What is the InChIKey of 8-hydroxyoctadec-17-en-9,11-diynoic acid?
The InChIKey is KWLVIGJGNBJKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h2,17,19H,1,3-6,9-10,12-13,15-16H2,(H,20,21).
What are the key properties of 8-hydroxyoctadec-17-en-9,11-diynoic acid?
8-hydroxyoctadec-17-en-9,11-diynoic acid has a molecular weight of 290.40 g/mol, XLogP of 3.53, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoctadec-17-en-9,11-diynoic acid is sourced from PubChem (CID 5312840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).