About (2R)-2-hydroxyoctanoic acid
(2R)-2-hydroxyoctanoic acid (PubChem CID 5312860) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R)-2-hydroxyoctanoic acid.
Molecular Properties
| Compound Name | (2R)-2-hydroxyoctanoic acid |
| PubChem CID | 5312860 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R)-2-hydroxyoctanoic acid |
| SMILES | CCCCCC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C8H16O3/c1-2-3-4-5-6-7(9)8(10)11/h7,9H,2-6H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | JKRDADVRIYVCCY-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-hydroxyoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxyoctanoic acid?
The IUPAC name of (2R)-2-hydroxyoctanoic acid (CID 5312860) is (2R)-2-hydroxyoctanoic acid.
What is the SMILES notation for (2R)-2-hydroxyoctanoic acid?
The canonical SMILES for (2R)-2-hydroxyoctanoic acid is CCCCCC[C@@H](O)C(=O)O.
What is the InChIKey of (2R)-2-hydroxyoctanoic acid?
The InChIKey is JKRDADVRIYVCCY-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H16O3/c1-2-3-4-5-6-7(9)8(10)11/h7,9H,2-6H2,1H3,(H,10,11)/t7-/m1/s1.
What are the key properties of (2R)-2-hydroxyoctanoic acid?
(2R)-2-hydroxyoctanoic acid has a molecular weight of 160.21 g/mol, XLogP of 1.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxyoctanoic acid is sourced from PubChem (CID 5312860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).