About butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane
butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane (PubChem CID 531330) has the molecular formula C17H32OSi
and a molecular weight of 280.53 g/mol. Its IUPAC name is butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane.
Molecular Properties
| Compound Name | butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane |
| PubChem CID | 531330 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane |
| SMILES | C=C(C)C#CC(O[Si](C)(C)CCCC)C(C)CCC |
| InChI | InChI=1S/C17H32OSi/c1-8-10-14-19(6,7)18-17(13-12-15(3)4)16(5)11-9-2/h16-17H,3,8-11,14H2,1-2,4-7H3 |
| InChIKey | BBBIYNLMODGBKF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
The IUPAC name of butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane (CID 531330) is butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane.
What is the SMILES notation for butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
The canonical SMILES for butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane is C=C(C)C#CC(O[Si](C)(C)CCCC)C(C)CCC.
What is the InChIKey of butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
The InChIKey is BBBIYNLMODGBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32OSi/c1-8-10-14-19(6,7)18-17(13-12-15(3)4)16(5)11-9-2/h16-17H,3,8-11,14H2,1-2,4-7H3.
What are the key properties of butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane?
butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane has a molecular weight of 280.53 g/mol, XLogP of 5.39, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(2,6-dimethylnon-1-en-3-yn-5-yloxy)-dimethylsilane is sourced from PubChem (CID 531330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).