C44H73NO8P+ — CID 5313547
2-[[(2R)-2,3-bis[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 5313547) has the molecular formula C44H73NO8P+ and a molecular weight of 775.04 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 5313547 |
| Molecular Formula | C44H73NO8P+ |
| Molecular Weight | 775.04 g/mol |
| Exact Mass | 774.51 |
| IUPAC Name | 2-[[(2R)-2,3-bis[[(9Z,11E,13E,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C=C\C=C\C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C=C\C=C\C=C/CC |
| InChI | InChI=1S/C44H72NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45(3,4)5)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-23,42H,6-7,24-41H2,1-5H3/p+1/b10-8-,11-9-,14-12+,15-13+,18-16+,19-17+,22-20-,23-21-/t42-/m1/s1 |
| InChIKey | DDKZSATYMHCURC-VZUFYJQKSA-O |
| XLogP | 11.01 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.04 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|