C23H26ClN5O2 — CID 53135823
N-butyl-1-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 53135823) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is N-butyl-1-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53135823 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-butyl-1-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2ncccc2-c2nc(-c3ccc(Cl)cc3)no2)CC1 |
| InChI | InChI=1S/C23H26ClN5O2/c1-2-3-12-26-22(30)17-10-14-29(15-11-17)21-19(5-4-13-25-21)23-27-20(28-31-23)16-6-8-18(24)9-7-16/h4-9,13,17H,2-3,10-12,14-15H2,1H3,(H,26,30) |
| InChIKey | UAZZVGGKIPKXPU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|