C17H22N4O3S — CID 53136260
N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methyl-3,5-dioxopyridazino[4,5-b][1,4]thiazin-6-yl)acetamide (PubChem CID 53136260) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methyl-3,5-dioxopyridazino[4,5-b][1,4]thiazin-6-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methyl-3,5-dioxopyridazino[4,5-b][1,4]thiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 53136260 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methyl-3,5-dioxopyridazino[4,5-b][1,4]thiazin-6-yl)acetamide |
| SMILES | CN1C(=O)CSc2cnn(CC(=O)NCCC3=CCCCC3)c(=O)c21 |
| InChI | InChI=1S/C17H22N4O3S/c1-20-15(23)11-25-13-9-19-21(17(24)16(13)20)10-14(22)18-8-7-12-5-3-2-4-6-12/h5,9H,2-4,6-8,10-11H2,1H3,(H,18,22) |
| InChIKey | KPVXZKBJGPQLNI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|