C17H14ClFN4O3S — CID 53136572
N-(2-chloro-5-fluorophenyl)-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide (PubChem CID 53136572) has the molecular formula C17H14ClFN4O3S and a molecular weight of 408.84 g/mol. Its IUPAC name is N-(2-chloro-5-fluorophenyl)-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide.
| Compound Name | N-(2-chloro-5-fluorophenyl)-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 53136572 |
| Molecular Formula | C17H14ClFN4O3S |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-(2-chloro-5-fluorophenyl)-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide |
| SMILES | C=CCN1C(=O)CSc2cnn(CC(=O)Nc3cc(F)ccc3Cl)c(=O)c21 |
| InChI | InChI=1S/C17H14ClFN4O3S/c1-2-5-22-15(25)9-27-13-7-20-23(17(26)16(13)22)8-14(24)21-12-6-10(19)3-4-11(12)18/h2-4,6-7H,1,5,8-9H2,(H,21,24) |
| InChIKey | IFWSOSKWWOFMBC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|