C18H17FN4O3S — CID 53136576
2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 53136576) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 53136576 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | C=CCN1C(=O)CSc2cnn(CC(=O)Nc3cc(F)ccc3C)c(=O)c21 |
| InChI | InChI=1S/C18H17FN4O3S/c1-3-6-22-16(25)10-27-14-8-20-23(18(26)17(14)22)9-15(24)21-13-7-12(19)5-4-11(13)2/h3-5,7-8H,1,6,9-10H2,2H3,(H,21,24) |
| InChIKey | DGRMMOBEZWAIPF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|