C18H16ClFN4O3S — CID 53136581
N-[(3-chloro-4-fluorophenyl)methyl]-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide (PubChem CID 53136581) has the molecular formula C18H16ClFN4O3S and a molecular weight of 422.87 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 53136581 |
| Molecular Formula | C18H16ClFN4O3S |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(3,5-dioxo-4-prop-2-enylpyridazino[4,5-b][1,4]thiazin-6-yl)acetamide |
| SMILES | C=CCN1C(=O)CSc2cnn(CC(=O)NCc3ccc(F)c(Cl)c3)c(=O)c21 |
| InChI | InChI=1S/C18H16ClFN4O3S/c1-2-5-23-16(26)10-28-14-8-22-24(18(27)17(14)23)9-15(25)21-7-11-3-4-13(20)12(19)6-11/h2-4,6,8H,1,5,7,9-10H2,(H,21,25) |
| InChIKey | UFUFGZAVZWWZSY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|