C21H18FN3O4 — CID 53136850
methyl 4-[[2-[2-(4-fluorophenyl)-6-methylpyrimidin-4-yl]oxyacetyl]amino]benzoate (PubChem CID 53136850) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is methyl 4-[[2-[2-(4-fluorophenyl)-6-methylpyrimidin-4-yl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(4-fluorophenyl)-6-methylpyrimidin-4-yl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 53136850 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | methyl 4-[[2-[2-(4-fluorophenyl)-6-methylpyrimidin-4-yl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COc2cc(C)nc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H18FN3O4/c1-13-11-19(25-20(23-13)14-3-7-16(22)8-4-14)29-12-18(26)24-17-9-5-15(6-10-17)21(27)28-2/h3-11H,12H2,1-2H3,(H,24,26) |
| InChIKey | HVTHCTZGURCRST-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |