C22H45NO8P+ — CID 5313802
2-[(3-hexanoyloxy-2-octanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 5313802) has the molecular formula C22H45NO8P+ and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-[(3-hexanoyloxy-2-octanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(3-hexanoyloxy-2-octanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 5313802 |
| Molecular Formula | C22H45NO8P+ |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-[(3-hexanoyloxy-2-octanoyloxypropoxy)-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC(=O)OC(COC(=O)CCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C22H44NO8P/c1-6-8-10-11-13-15-22(25)31-20(18-28-21(24)14-12-9-7-2)19-30-32(26,27)29-17-16-23(3,4)5/h20H,6-19H2,1-5H3/p+1 |
| InChIKey | ZSVLXFAJSWBGGE-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|