C24H30N4O2S — CID 53139630
2-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)-4H-thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 53139630) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 2-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)-4H-thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)-4H-thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 53139630 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cc1sc2cc(C(=O)NCc3ccc(N4CCOCC4)cc3)[nH]c2c1CN1CCCC1 |
| InChI | InChI=1S/C24H30N4O2S/c1-17-20(16-27-8-2-3-9-27)23-22(31-17)14-21(26-23)24(29)25-15-18-4-6-19(7-5-18)28-10-12-30-13-11-28/h4-7,14,26H,2-3,8-13,15-16H2,1H3,(H,25,29) |
| InChIKey | OSQVUSMFOOCKQU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|