C23H27N3O4 — CID 53140379
N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carboxamide (PubChem CID 53140379) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carboxamide |
|---|---|
| PubChem CID | 53140379 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carboxamide |
| SMILES | COCCn1cc2c3c(cccc31)CN(C(=O)Nc1ccc(OC)cc1OC)CC2 |
| InChI | InChI=1S/C23H27N3O4/c1-28-12-11-25-14-17-9-10-26(15-16-5-4-6-20(25)22(16)17)23(27)24-19-8-7-18(29-2)13-21(19)30-3/h4-8,13-14H,9-12,15H2,1-3H3,(H,24,27) |
| InChIKey | LFNPMMDLNHHOOQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |