C20H18FN3O3 — CID 53140897
(E)-1-[3-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 53140897) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is (E)-1-[3-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 53140897 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (E)-1-[3-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)N1CCCC(c2noc(-c3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C20H18FN3O3/c21-16-6-1-4-14(12-16)20-22-19(23-27-20)15-5-2-10-24(13-15)18(25)9-8-17-7-3-11-26-17/h1,3-4,6-9,11-12,15H,2,5,10,13H2/b9-8+ |
| InChIKey | YTWGASUVOSCPGY-CMDGGOBGSA-N |
| XLogP | 3.89 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|