About 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole
5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole (PubChem CID 53141001) has the molecular formula C16H10BrN3O2
and a molecular weight of 356.18 g/mol. Its IUPAC name is 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole |
| PubChem CID | 53141001 |
| Molecular Formula | C16H10BrN3O2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2cc(-c3noc(-c4ccccc4Br)n3)ccc2o1 |
| InChI | InChI=1S/C16H10BrN3O2/c1-9-18-13-8-10(6-7-14(13)21-9)15-19-16(22-20-15)11-4-2-3-5-12(11)17/h2-8H,1H3 |
| InChIKey | JOCCEPNIPOOGBQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole?
The IUPAC name of 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole (CID 53141001) is 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole.
What is the SMILES notation for 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole?
The canonical SMILES for 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole is Cc1nc2cc(-c3noc(-c4ccccc4Br)n3)ccc2o1.
What is the InChIKey of 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole?
The InChIKey is JOCCEPNIPOOGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrN3O2/c1-9-18-13-8-10(6-7-14(13)21-9)15-19-16(22-20-15)11-4-2-3-5-12(11)17/h2-8H,1H3.
What are the key properties of 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole?
5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole has a molecular weight of 356.18 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(2-bromophenyl)-1,2,4-oxadiazol-3-yl]-2-methyl-1,3-benzoxazole is sourced from PubChem (CID 53141001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).