C18H20O3 — CID 5314186
1-hydroxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione (PubChem CID 5314186) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-hydroxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione.
| Compound Name | 1-hydroxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione |
|---|---|
| PubChem CID | 5314186 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-hydroxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione |
| SMILES | O=C1C2=C(C(=O)C3C4C=CC(CC4)C13)C1(O)CCC2CC1 |
| InChI | InChI=1S/C18H20O3/c19-16-12-9-1-3-10(4-2-9)13(12)17(20)15-14(16)11-5-7-18(15,21)8-6-11/h1,3,9-13,21H,2,4-8H2 |
| InChIKey | GZAZRPSKJQMUHE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|