C20H29N5O4S — CID 53142726
3-[4-(2-ethoxyphenyl)piperazin-1-yl]sulfonyl-1-methyl-N-propylpyrazole-4-carboxamide (PubChem CID 53142726) has the molecular formula C20H29N5O4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 3-[4-(2-ethoxyphenyl)piperazin-1-yl]sulfonyl-1-methyl-N-propylpyrazole-4-carboxamide.
| Compound Name | 3-[4-(2-ethoxyphenyl)piperazin-1-yl]sulfonyl-1-methyl-N-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53142726 |
| Molecular Formula | C20H29N5O4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-[4-(2-ethoxyphenyl)piperazin-1-yl]sulfonyl-1-methyl-N-propylpyrazole-4-carboxamide |
| SMILES | CCCNC(=O)c1cn(C)nc1S(=O)(=O)N1CCN(c2ccccc2OCC)CC1 |
| InChI | InChI=1S/C20H29N5O4S/c1-4-10-21-19(26)16-15-23(3)22-20(16)30(27,28)25-13-11-24(12-14-25)17-8-6-7-9-18(17)29-5-2/h6-9,15H,4-5,10-14H2,1-3H3,(H,21,26) |
| InChIKey | NEUIQZJFXMNMKC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |