C20H28ClN5O4S — CID 53142803
3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(2-methoxyethyl)-1-propylpyrazole-4-carboxamide (PubChem CID 53142803) has the molecular formula C20H28ClN5O4S and a molecular weight of 470.00 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(2-methoxyethyl)-1-propylpyrazole-4-carboxamide.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(2-methoxyethyl)-1-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53142803 |
| Molecular Formula | C20H28ClN5O4S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-N-(2-methoxyethyl)-1-propylpyrazole-4-carboxamide |
| SMILES | CCCn1cc(C(=O)NCCOC)c(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C20H28ClN5O4S/c1-3-8-25-15-18(19(27)22-7-13-30-2)20(23-25)31(28,29)26-11-9-24(10-12-26)17-6-4-5-16(21)14-17/h4-6,14-15H,3,7-13H2,1-2H3,(H,22,27) |
| InChIKey | NQQZJEZQLQJKIG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|