C16H12FN3O2 — CID 53143060
2-(2-fluorophenyl)-N-(3-pyridin-3-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 53143060) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(3-pyridin-3-yl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-(3-pyridin-3-yl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 53143060 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(3-pyridin-3-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | O=C(Cc1ccccc1F)Nc1cc(-c2cccnc2)no1 |
| InChI | InChI=1S/C16H12FN3O2/c17-13-6-2-1-4-11(13)8-15(21)19-16-9-14(20-22-16)12-5-3-7-18-10-12/h1-7,9-10H,8H2,(H,19,21) |
| InChIKey | NMAFYQICFKSSMV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |