About N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide
N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 53143076) has the molecular formula C17H12F3N3O2
and a molecular weight of 347.30 g/mol. Its IUPAC name is N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 53143076 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)Nc1cc(-c2ccccn2)no1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)12-5-3-4-11(8-12)9-15(24)22-16-10-14(23-25-16)13-6-1-2-7-21-13/h1-8,10H,9H2,(H,22,24) |
| InChIKey | UFJJMYZGKAEYFM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide (CID 53143076) is N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide is O=C(Cc1cccc(C(F)(F)F)c1)Nc1cc(-c2ccccn2)no1.
What is the InChIKey of N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide?
The InChIKey is UFJJMYZGKAEYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N3O2/c18-17(19,20)12-5-3-4-11(8-12)9-15(24)22-16-10-14(23-25-16)13-6-1-2-7-21-13/h1-8,10H,9H2,(H,22,24).
What are the key properties of N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide?
N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide has a molecular weight of 347.30 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-pyridin-2-yl-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 53143076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).